CHEM 11 Spring 2015 Practice Exam 3 PDF

CHEM 11 Spring 2015 Practice Exam 3 1. A hemiacetal contains A) an OH (hydroxyl) group and an OR (alkoxy) group. B) an OH (hydroxyl) group and an OR (alkoxy) group bonded to the same carbon. C) two OR groups (alkoxy groups) bonded to the same carbon. D) two OR g...

CHEM 11 Spring 2015 Practice Exam 3 1. A hemiacetal contains A) an OH (hydroxyl) group and an OR (alkoxy) group. B) an OH (hydroxyl) group and an OR (alkoxy) group bonded to the same carbon. C) two OR groups (alkoxy groups) bonded to the same carbon. D) two OR groups (alkoxy groups). 2. What type of compound is shown here? A) an acetal B) a hemiacetal C) an ether D) an acetal and an ether 3. O The functional group R C O H is characteristic of A) carboxylic acids. B) aldehydes. C) ketones. D) esters. E) ethers. 4. O The functional group R C O R' is characteristic of A) carboxylic acids. B) aldehydes. C) ketones. D) esters. E) ethers. Page 1 5. What is the name of the compound shown here? A) 3-bromobenzoic acid B) 4-bromobenzoic acid C) 1-bromo-3-carboxylbenzene D) 3-bromo-1-carboxylbenzene 6. Which compound has the lowest boiling point? A) CH3(CH2)5CONH2 B) CH3CH2CON(CH2CH3)2 C) CH3CH2CH2CH2CONHCH2CH3 D) All of the compounds above have the same boiling point. 7. Heating a carboxylic acid with a primary amine forms _____ + water. A) a primary amide B) a secondary amide C) a tertiary amide D) an ester 8. Which name is possible for a carboxylic acid? A) 1-chloropentanoic acid B) 2-pentylbutanoic acid C) m-butylbenzoic acid D) 5-bromo-4-chloro-2,5-dimethyl-3-nitro-5-propylnonanoic acid Page 2  9. Which compound is a secondary amide? A) B) C) D) E) 10. What is the IUPAC name for the substance having the following condensed structural formula? (CH3)3CCH2COOH A) 3,3-dimethylbutanoic acid B) hexanoic acid C) 3,3-dimethyl-1-butanone D) 4,4-dimethylpentanal E) 3,3-dimethylpropanoic acid Page 3 11. Which is the structure of sodium hexanoate? A) B) C) D) 12. What is the IUPAC name of the compound shown here? A) propanamide B) propylamide C) N-propanamide D) N-propylamide Page 4 13. What is the structure of 2-chloro-3-hydroxy-4-methylpentanoic acid? A) B) C) D) 14. Which compound has the highest boiling point? A) (CH3)2CHCH2COOCH3 B) CH3CH2CH2CH2CH2COOH C) (CH3)2CHCH2CH2CH2OH D) CH3(CH2)6CH3 E) All of the compounds above have the same boiling point. 15. What products are produced when a carboxylic acid reacts with an alcohol, in the presence of sulfuric acid? A) a carboxylate ion B) an ammonium salt C) an amide + water D) an ether + water E) an ester + water Page 5 16. Carboxylic acids react with bases, such as NaOH, to form _____. A) alcohols B) water-soluble salts C) carboxylate anions + H3O+ D) carboxylic acids 17. What is the treatment of a carboxylic acid (RCOOH) with an alcohol (R'OH) in the presence of an acid catalyst to form an ester (RCOOR') called? A) an addition reaction B) a Fischer esterification C) an acid–base reaction D) a saponification Page 6 18. Which reagent, when reacted with dimethylamine, would produce the compound shown here? A) B) C) D) N(CH3)3 19. What products are formed in the acid hydrolysis of ? A) ethanol and acetic acid B) acetic acid and water C) methanol and propanal D) ethanol and water E) ethanal and ethanol Page 7 20. Which compound is the most soluble in water? A) (CH3)2CHCH2COOCH3 B) CH3CH2CH2CH2CH2COOH C) CH3(CH2)6CH3 D) CH3CH2CH2CH2CH2COOK 21. Which of these structures represents a soap? A) CH3CO2– K+ B) CH3(CH2)14CO2– Na+ C) CH3(CH2)12COOH D) CH3(CH2)7CO2(CH2)7Na E) More than one of the compounds above is a soap. 22. What is the IUPAC name of the compound shown here? A) propylhexylamine B) N-propylhexanamine C) N-propyl-1-hexanamine D) hexylpropylamine E) N-hexylpropanamine 23. What is the IUPAC name of the compound shown here? A) butylheptylamine B) N-butylheptanamine C) N-butyl-4-heptanamine D) dibutylpropylamine E) N-4-heptylbutanamine 24. Which compound has the lowest boiling point? A) (CH3)2CHNHCH2CH2CH2CH3 B) CH3CH2CH2CH2CH2CH2CH2NH2 C) (CH3)2NCH2CH2CH2CH2CH3 D) All of the compounds above have the same boiling point. Page 8 25. What are the products in the acid–base reaction? + HNO3  A) B) + NO3 C) + NO3 D) + OH  E) No reaction occurs. Page 9 26. What is the IUPAC name of the compound shown here? Cl  A) ethylmethylpropylammonium chloride B) N-ethyl-N-methylpropanammonium chloride C) N-ethyl-N-methylpropylammonia chloride D) N-methyl-N-propylethanammonium chloride E) N-ethyl-N-methylpropylammonium chloride 27. Which substance is a weak acid in aqueous solution? A) CH3OH B) CH3COOH C) CH3NH2 D) CH3OCH3 E) CH3COOCH3 28. Which substance is a weak base in aqueous solution? A) CH3OH B) CH3COOH C) CH3NH2 D) CH3OCH3 E) CH3COOCH3 29. What are monosaccharides with a carbonyl group at C1 called? A) anomers B) aldoses C) ketoses D) alditols Page 10 30. What is the classification of the compound shown here? A) an aldotriose B) a ketotriose C) an aldopentose D) a ketopentose E) a ketotetrose 31. Which compound is the most soluble in water? A) CHOCHOHCHOHCHOHCHOHCH2OH B) CH3CH2CH=CHCH2CH=CHCH2CH2CH2CH2CH2CH2CH2COOH C) CH3CH2CH2CH2CH2CH2CH2CH2CH3 D) CH3CH2CH2CH2CH2CH2CH2CH2OH 32. When converting a Fischer projection to a Haworth projection, where are all of the substituents on the right side of the carbon skeleton drawn in the Haworth projection? A) down B) up C) down in an  anomer and up in a  anomer D) down in a  anomer and up in an  anomer Page 11 33. Which naturally-occurring monosaccharide forms the Haworth structure shown? A) B) Page 12 C) D) E) Page 13 34. Which is not an example of a lipid? A) phenol B) triacylglycerol C) cholesterol D) vitamin E 35. What functional group is contained in most hydrolyzable lipids? A) amide B) ether C) ester D) carboxylic acid E) hydroxy 36. Linolenic acid, CH3CH2CH=CHCH2CH=CHCH2CH2CH2CH2CH2CH2CH2COOH, is _____. A) an omega-6 acid B) an omega-3 acid C) an omega-9 acid D) an omega-14 acid 37. Which compound is most likely to be an oil at the lowest temperature? A) CH3(CH2)14COOH B) CH3(CH2)10CH=CH(CH2)2COOH C) CH3(CH2)2CH=CH(CH2)4CH=CH(CH2)4COOH D) CH3(CH2)2CH=CH(CH2)2CH=CH(CH2)2CH=CH(CH2)2COOH 38. What two types of compounds react to form a wax? A) a fatty acid and an amide B) a high molecular weight alcohol and a steroid C) a fatty acid and a high molecular weight alcohol D) an ester and a fatty acid Page 14 39. What are the products in the acid–base reaction? + LiOH  A) B) C) D) E) No reaction occurs. 40. What process uses integral proteins to move ions, specifically Na+, K+, and Ca2+, through a cell membrane, traveling against the concentration gradient from the side of lower concentration to the side of higher concentration? A) facilitated transport B) diffusion C) active transport Page 15 41. Which structure is the steroid skeleton? A) B) C) D) Page 16 42. What is the main component of the cell membrane? A) triacylglycerols B) phospholipids C) steroids D) leukotrienes E) prostaglandins 43. Which type of linkage between the two rings is in the structure shown? A) 14--glycoside linkage B) 14--glycoside linkage C) 11--glycoside linkage D) 11--glycoside linkage E) 12--glycoside linkage 44. What is the structure of amylopectin? A) unbranched skeleton of glucose molecules joined by 14--glycoside linkages B) branched skeleton of glucose molecules joined by 14--glycoside linkages C) unbranched skeleton of glucose molecules joined by 14--glycoside linkages D) branched skeleton of glucose molecules joined by 14--glycoside linkages Page 17  45. What type of polysaccharide is depicted in the “cartoon” shown? A) cellulose B) amylose C) amylopectin D) chitin For the following questions, you will be provided with an amino acid table and a codon table during the exam. 46. Which is the simplest amino acid? A) serine B) glutamine C) cysteine D) glycine E) valine 47. Which amino acid is an acidic amino acid? A) lysine B) aspartic acid C) glycine D) phenylalanine E) isoleucine Page 18 48. What is the charge on alanine at a pH equal to the pI? A) positive B) neutral C) negative Page 19 49. What is the structure of the amino acid leucine at pH 12? A) B) C) D) Page 20 50. The term protein is usually reserved for polymers of more than _____ amino acids. A) 3 B) 10 C) 40 D) 100 E) 1,000 51. How many different dipeptides can be formed when one valine reacts with one glycine? A) 1 B) 2 C) 3 D) 4 52. What is the N-terminal amino acid in the tetrapeptide glycylalanylisoleucylmethionine? A) alanine B) glycine C) methionine D) isoleucine Page 21 53. What is the structure of the dipeptide Ser–Gly? A) B) C) D) 54. What is the strongest type of interaction between two cysteine amino acids in a protein? A) hydrogen bonding B) London dispersion forces C) disulfide bond D) electrostatic interactions 55. What is the strongest type of interaction between an isoleucine amino acid and a phenylalanine amino acid in a protein? A) hydrogen bonding B) London dispersion forces C) disulfide bond D) electrostatic interactions Page 22 56. What is the process of altering the shape of a protein without breaking the amide bonds that form the primary structure? A) hydrolysis B) competitive inhibition C) denaturation D) oxidation 57. From the name alone, which compound is an enzyme? A) glucose B) triosephosphate isomerase C) N-acetyl-D-glucosamine D) dihydrofolate 58. What is the three-dimensional arrangement of localized regions of a protein into -helices and  -pleated sheets called? A) the primary structure of a protein B) the secondary structure of a protein C) the tertiary structure of a protein D) the quaternary structure of a protein 59. Which is not a characteristic of an -helix? A) The N–H and C=O bonds point along the axis of the helix in opposite directions. B) The R groups of the amino acids extend inward from the core of the helix. C) There are 3.6 amino acids in each turn of the helix. D) The C=O group of one amino acid is hydrogen bonded to an N–H group four amino acid residues farther along the chain. 60. Which amino acid is most likely to be located in the interior of a globular protein? A) arginine B) histidine C) leucine D) aspartic acid Page 23 61. What is the structure of the amino acid leucine at pH 1? A) B) C) D) Page 24 62. Which is an example of a globular protein? A) collagen B) -keratin C) hemoglobin D) amylopectin 63. What type of inhibitor binds to the enzyme but does not bind at the active site? A) a noncompetitive inhibitor B) a competitive inhibitor C) a reversible inhibitor D) an irreversible inhibitor 64. Which component is not part of a nucleotide? A) a nitrogen-containing base B) a monosaccharide C) an amino acid D) a phosphate group 65. Which base is found in DNA or RNA, but not both? A) uracil B) cytosine C) adenine D) guanine 66. What is a nucleoside? A) a monosaccharide + a base B) a polymer of ribonucleotides C) the monosaccharides ribose and deoxyribose D) a monosaccharide + a base + phosphate 67. A polynucleotide contains _____ A) one free phosphate group at the 5' end. B) a backbone of alternating sugar and base groups. C) one free phosphate group at the 1' end. D) one free OH group at the 5' end. Page 25 68. How many hydrogen bonds form between a G–C base pair in a DNA double helix? A) 0 B) 1 C) 2 D) 3 E) 4 69. What is the complementary strand for the DNA strand 5'–AAGGTAGC–3'? A) 5'–AAGGTAGC–3' B) 3'–AAGGTAGC–5' C) 3'–TTCCATCG–5' D) 5'–TTCCATCG–3' E) 3'–UUCCAUCG–5' 70. What is the process by which DNA makes a copy of itself when a cell divides? A) transcription B) replication C) translation 71. What is the step in the synthesis of proteins from RNA called where the genetic message contained in RNA determines the specific amino acid sequence of a protein? A) transcription B) replication C) translation 72. Which is not a type of RNA molecule? A) mRNA B) dRNA C) tRNA D) rRNA 73. Which statement is not true? A) It is possible for two different codons to code for the same amino acid. B) There are 64 different codons. C) Three codons are called stop codons. D) Three codons are called start codons. Page 26 74. Which is not one of the three stages in translation? A) termination B) initiation C) elongation D) mutation 75. What is the amino acid sequence that is coded by mRNA sequence 5' AAG GCU AGU GGC 3'? A) Thr–His–Asn–Asp B) Lys–Ala–Ser–Gly C) Asp–Asn–His–Thr D) Gly–Ser–Ala–Lys 76. Which codon does not code for alanine? A) GCG B) GCU C) GCC D) GCA E) GAC 77. Each individual tRNA contains _____ A) a base sequence that is identical to the informational strand of DNA. B) the sequence of codons that determines the order of amino acids in the protein. C) an anticodon of three nucleotides that is complementary to the codon in mRNA and identifies individual amino acids. D) an anticodon complementary to any of the three stop codons. 78. What polypeptide would be synthesized from the following template strand of DNA: 3' CGG AGA CGG ACG 5'? A) Ala–Ser–Ala–Cys B) Arg–Arg–Arg–Cys C) Gln–Lys–Gln–Met D) Val – Lys – Val – Tyr E) Cys–Ala–Ser–Ala 79. Which type of mutation is expressed when a DNA sequence changes from GGA TCA CCG GAA…. to GGA TCC CGG….? A) a deletion mutation B) an insertion mutation C) a point mutation Page 27 80. A DNA sequence segment is initially AAA ATG TGA CCC. Which mutation would have the largest effect on the resultant protein synthesized? (Codon table provided on exam.) A) AAG ATG TGA CCC B) AAA ATT TGA CCC C) AAA ATG GAC CCU D) AAA ATG TGA CGC Page 28 Answer Key 1. B 2. C 3. A 4. D 5. A 6. B 7. B 8. C 9. D 10. A 11. B 12. A 13. B 14. B 15. E 16. B 17. B 18. C 19. A 20. D 21. B 22. C 23. C 24. C 25. B 26. B 27. B 28. C 29. B 30. E 31. A 32. A 33. B 34. A 35. C 36. B 37. D 38. C 39. C 40. C 41. C 42. B 43. E 44. B Page 29 45. C 46. D 47. B 48. B 49. D 50. C 51. B 52. B 53. B 54. C 55. B 56. C 57. B 58. B 59. B 60. C 61. C 62. C 63. A 64. C 65. A 66. A 67. A 68. D 69. C 70. B 71. C 72. B 73. D 74. D 75. B 76. E 77. C 78. A 79. A 80. B Page 30