Podcast
Questions and Answers
What is the IUPAC name of the compound CH3-CH=CH2?
What is the IUPAC name of the compound CH3-CH=CH2?
But-1-ene
Provide the IUPAC name for the compound CH3-CH2-C≡C-CH3.
Provide the IUPAC name for the compound CH3-CH2-C≡C-CH3.
Pent-2-yne
What is the IUPAC name of the compound CH3-CH2-CH2-CH2-CH2-C≡CH?
What is the IUPAC name of the compound CH3-CH2-CH2-CH2-CH2-C≡CH?
Hept-1-yne
What is the name of the alkyl group obtained by removing a hydrogen atom from an alkane?
What is the name of the alkyl group obtained by removing a hydrogen atom from an alkane?
How are the branches or substituents named in branched chain alkanes?
How are the branches or substituents named in branched chain alkanes?
What are the rules recommended by IUPAC for naming a branched chain alkane?
What are the rules recommended by IUPAC for naming a branched chain alkane?
What is the correct IUPAC name for the compound CH3CH(CH3)CH2CH(CH3)CH(CH3)CH3?
What is the correct IUPAC name for the compound CH3CH(CH3)CH2CH(CH3)CH(CH3)CH3?
Why are the prefixes sec- and tert- not considered to be part of the fundamental name in IUPAC nomenclature of alkanes?
Why are the prefixes sec- and tert- not considered to be part of the fundamental name in IUPAC nomenclature of alkanes?
How are identical substituent groups indicated in IUPAC nomenclature?
How are identical substituent groups indicated in IUPAC nomenclature?
In the IUPAC nomenclature, why is the carbon atom of the branch that attaches to the root alkane numbered as 1 when naming branched alkyl groups?
In the IUPAC nomenclature, why is the carbon atom of the branch that attaches to the root alkane numbered as 1 when naming branched alkyl groups?
Study Notes
IUPAC Nomenclature of Alkanes
- The IUPAC name of the compound CH3-CH=CH2 is Prop-1-ene.
- The IUPAC name of the compound CH3-CH2-C≡C-CH3 is 2-Butyne.
- The IUPAC name of the compound CH3-CH2-CH2-CH2-CH2-C≡CH is 1-Hexyne.
Alkyl Groups
- The alkyl group obtained by removing a hydrogen atom from an alkane is called an alkyl group.
- Alkyl groups are named by replacing the -ane suffix of the alkane with -yl.
Branches and Substituents in Branched Chain Alkanes
- Branches or substituents in branched chain alkanes are named as alkyl groups.
- The chains are numbered starting from the end that is closest to the branch.
IUPAC Rules for Naming Branched Chain Alkanes
- The parent hydrocarbon chain is the longest continuous chain in the molecule.
- The parent chain is numbered from the end that is closest to the branch.
- The branches are named as alkyl groups and are numbered based on their position on the parent chain.
- The prefixes di-, tri-, and tetra- are used to indicate the number of identical substituent groups.
Specific Compound Names
- The correct IUPAC name for the compound CH3CH(CH3)CH2CH(CH3)CH(CH3)CH3 is 2,4,4-Trimethylpentane.
Sec- and Tert- Prefixes
- The prefixes sec- and tert- are not considered to be part of the fundamental name in IUPAC nomenclature of alkanes.
- They are used to indicate the type of carbon atom that a substituent is attached to.
Identical Substituent Groups
- Identical substituent groups are indicated by the prefixes di-, tri-, and tetra-.
Branch Carbon Atom Numbering
- The carbon atom of the branch that attaches to the root alkane is numbered as 1 when naming branched alkyl groups.
- This is because the branch is considered to be a substituent of the parent chain.
Studying That Suits You
Use AI to generate personalized quizzes and flashcards to suit your learning preferences.
Description
Test your knowledge on the nomenclature of branched chain alkanes, which involves understanding functional groups, alkyl groups, and common branch names like methyl, ethyl, propyl, and butyl.