5 Questions
What is the systematic name for the structure with the molecular formula C₆H₁₂F?
Fluor-3,5-dimethylhexane
Which compound is identified as 3-ethyl-3,3-dimethylpentane?
3-ethyl-3,3-dimethylpentane
Which is the correct name for a compound with the molecular formula C₁₁H₂₄?
Undecane
Identify the compound with the molecular formula C₈H₁₆ that contains a fluorine atom.
1,1-Difluoro-2,2-dimethylbutane
What is the name of the compound with the following structure: CH₃-CH₂-CH₂-CH₂-CH₂-CH₂-CH₂-CH₃?
Octane
Study Notes
Systematic Nomenclature of Organic Compounds
a. Fluor-3,5-dimethylhexane
- Molecular structure: H3C-C(CH3)2-CHF-CH2-CH(CH3)2
- Functional groups: Fluorine (F) and methyl (CH3) groups
b. 3-Ethyl-3,3-dimethylpentane
- Molecular structure: CH3CH2C(CH3)2CH2CH3
- Functional groups: Ethyl (CH2CH3) and methyl (CH3) groups
c. 1-Bromo-3-ethyl-2,2-dimethylhexane
- Molecular structure: BrCH2CH(CH3)CH(CH3)2CHFCH3
- Functional groups: Bromine (Br), ethyl (CH2CH3), and methyl (CH3) groups
d. Undecane
- Molecular structure: CH3(CH2)9CH3
- Functional group: Methyl (CH3) group
e. 5,5-Dimethyloctane
- Molecular structure: CH3CH2CH(CH3)2CH2CH2CH3
- Functional groups: Methyl (CH3) groups
f. 1,1-Difluoro-2,2-dimethylbutane
- Molecular structure: CF2CH(CH3)2CHFCH3
- Functional groups: Fluorine (F) and methyl (CH3) groups
g. Octane
- Molecular structure: CH3(CH2)6CH3
- Functional group: Methyl (CH3) group
h. 1-Bromo-2,6-dimethylhexane
- Molecular structure: BrCH2CH(CH3)CH2CH(CH3)CH3
- Functional groups: Bromine (Br) and methyl (CH3) groups
Given the structure formulas, identify the systematic names of the corresponding organic compounds. This quiz covers various types of organic molecules, including hydrocarbons and halogenated compounds.
Make Your Own Quizzes and Flashcards
Convert your notes into interactive study material.
Get started for free