Podcast
Questions and Answers
What is the systematic name for the structure with the molecular formula C₆H₁₂F?
What is the systematic name for the structure with the molecular formula C₆H₁₂F?
Which compound is identified as 3-ethyl-3,3-dimethylpentane?
Which compound is identified as 3-ethyl-3,3-dimethylpentane?
Which is the correct name for a compound with the molecular formula C₁₁H₂₄?
Which is the correct name for a compound with the molecular formula C₁₁H₂₄?
Identify the compound with the molecular formula C₈H₁₆ that contains a fluorine atom.
Identify the compound with the molecular formula C₈H₁₆ that contains a fluorine atom.
Signup and view all the answers
What is the name of the compound with the following structure: CH₃-CH₂-CH₂-CH₂-CH₂-CH₂-CH₂-CH₃?
What is the name of the compound with the following structure: CH₃-CH₂-CH₂-CH₂-CH₂-CH₂-CH₂-CH₃?
Signup and view all the answers
Study Notes
Systematic Nomenclature of Organic Compounds
a. Fluor-3,5-dimethylhexane
- Molecular structure: H3C-C(CH3)2-CHF-CH2-CH(CH3)2
- Functional groups: Fluorine (F) and methyl (CH3) groups
b. 3-Ethyl-3,3-dimethylpentane
- Molecular structure: CH3CH2C(CH3)2CH2CH3
- Functional groups: Ethyl (CH2CH3) and methyl (CH3) groups
c. 1-Bromo-3-ethyl-2,2-dimethylhexane
- Molecular structure: BrCH2CH(CH3)CH(CH3)2CHFCH3
- Functional groups: Bromine (Br), ethyl (CH2CH3), and methyl (CH3) groups
d. Undecane
- Molecular structure: CH3(CH2)9CH3
- Functional group: Methyl (CH3) group
e. 5,5-Dimethyloctane
- Molecular structure: CH3CH2CH(CH3)2CH2CH2CH3
- Functional groups: Methyl (CH3) groups
f. 1,1-Difluoro-2,2-dimethylbutane
- Molecular structure: CF2CH(CH3)2CHFCH3
- Functional groups: Fluorine (F) and methyl (CH3) groups
g. Octane
- Molecular structure: CH3(CH2)6CH3
- Functional group: Methyl (CH3) group
h. 1-Bromo-2,6-dimethylhexane
- Molecular structure: BrCH2CH(CH3)CH2CH(CH3)CH3
- Functional groups: Bromine (Br) and methyl (CH3) groups
Studying That Suits You
Use AI to generate personalized quizzes and flashcards to suit your learning preferences.
Description
Given the structure formulas, identify the systematic names of the corresponding organic compounds. This quiz covers various types of organic molecules, including hydrocarbons and halogenated compounds.
