Organic Chemistry: Alkanes and Functional Groups

What is the name of the alkane with 7 carbon atoms?

The suffix of an alkane name indicates the functional group present in the molecule.

What is the name of the branched substituent with the formula CH3CH2CH?

The longest carbon chain in a molecule is called the ______ chain.

Match the following substituents with their corresponding structures.

The IUPAC name of an acid amide is formed by replacing the '-e' in the name of the _______ alkane with '-amide'.

The IUPAC name of an alkyl nitrile is formed by adding the suffix '-nitrile' to the name of the parent alkane.

What is the IUPAC name of the acid chloride derived from propanoic acid?

What is the functional group present in acid chlorides?

Match the following compounds with their corresponding functional group:

What is the common name of the acid amide derived from butanoic acid?

Which of the following is NOT a common name for an alkyl nitrile?

The functional group -C≡N is associated with ______.

Which of the following is the IUPAC name for CH3CH2OHCH2OH?

The general formula for ethers is CnH2n+1-O-CmH2m+1, where n and m can represent the same or different numbers.

What is the common name for the ether with the molecular formula CH3OCH3?

Which of the following solvents would result in the highest enol content for acetoacetic ester?

In the IUPAC system for naming aldehydes, the suffix '-al' is added to the parent ______ name.

The enol content of pentană2,4ădione (CH3COCH2COCH3) is found to be ______% and ______% at 27.5Ĉ and 275.5ĈC respectively.

The anion formed when a strong base is added to a ketone with an -hydrogen atom is the same regardless of whether the ketone or enol form reacts.

Match the following functional groups with their corresponding IUPAC suffix:

Which of the following statements is true about alkoxy-alkanes?

Explain why the enol content of acetoacetic ester is lower in water than in toluene.

Match the following solvents with their corresponding enol content for acetoacetic ester:

The IUPAC name for CH3CH2OCH3 is Methoxymethane.

What is the functional group present in aldehydes?

Which of the following is NOT a factor that contributes to the stability of an enol form compared to a keto form?

In the keto form of a molecule, the Ar-C-Ar bond angle is typically wider than in the enol form.

What is the name of the phenomenon responsible for the increased stability of the enol form due to the interaction of the double bond with a carbonyl group?

The enol form of 2,2-dimesitylenthanal is favored over the keto form due to the ______ of the bulky aryl groups.

Match the following terms with their definitions:

What type of hydrogen bonding can occur in an enol form, contributing to its stability?

The enol form in general is always less stable than the keto form.

Which of the following factors can influence the equilibrium between the keto and enol forms?

What is the characteristic functional group for alkynes?

The prefix 'bis' is used to indicate the presence of two identical substituents on a molecule.

What is the IUPAC name of the compound with the structure CH3CH2CH2CH(CH3)CH2CH3?

The functional group in the compound CH3CH2CH2CHO is an ______ group.

Match the following functional groups with their corresponding symbols:

What is the IUPAC name of the compound with the structure CH3CH2CH2CH2CH2CH2CH(CH3)CH2CH2CH2CH3?

The suffix 'ol' is used to indicate the presence of an alkene group in a molecule.

What is the IUPAC name of the compound with the structure CH3CH2CH2COCH2CH3?

Which of the following factors contributes to the increased stability of the enol form of 2,2-dimesitylenthanal compared to its keto form?

In general, the enol form of a molecule is always more stable than the keto form.

In the keto form of 2,2-dimesitylenthanal, the Ar-C-Ar bond angle is approximately ______ degrees, while in the enol form, it is ______ degrees.